About 4-amino-N-(4,6-dimethoxypyrimidin-2-yl)-1-methylpyrrole-2-carboxamide
4-amino-N-(4,6-dimethoxypyrimidin-2-yl)-1-methylpyrrole-2-carboxamide (PubChem CID 107624352) has the molecular formula C12H15N5O3
and a molecular weight of 277.28 g/mol. Its IUPAC name is 4-amino-N-(4,6-dimethoxypyrimidin-2-yl)-1-methylpyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-(4,6-dimethoxypyrimidin-2-yl)-1-methylpyrrole-2-carboxamide |
| PubChem CID | 107624352 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 4-amino-N-(4,6-dimethoxypyrimidin-2-yl)-1-methylpyrrole-2-carboxamide |
| SMILES | COc1cc(OC)nc(NC(=O)c2cc(N)cn2C)n1 |
| InChI | InChI=1S/C12H15N5O3/c1-17-6-7(13)4-8(17)11(18)16-12-14-9(19-2)5-10(15-12)20-3/h4-6H,13H2,1-3H3,(H,14,15,16,18) |
| InChIKey | WAZKMMMYWHSEIH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-amino-N-(4,6-dimethoxypyrimidin-2-yl)-1-methylpyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(4,6-dimethoxypyrimidin-2-yl)-1-methylpyrrole-2-carboxamide?
The IUPAC name of 4-amino-N-(4,6-dimethoxypyrimidin-2-yl)-1-methylpyrrole-2-carboxamide (CID 107624352) is 4-amino-N-(4,6-dimethoxypyrimidin-2-yl)-1-methylpyrrole-2-carboxamide.
What is the SMILES notation for 4-amino-N-(4,6-dimethoxypyrimidin-2-yl)-1-methylpyrrole-2-carboxamide?
The canonical SMILES for 4-amino-N-(4,6-dimethoxypyrimidin-2-yl)-1-methylpyrrole-2-carboxamide is COc1cc(OC)nc(NC(=O)c2cc(N)cn2C)n1.
What is the InChIKey of 4-amino-N-(4,6-dimethoxypyrimidin-2-yl)-1-methylpyrrole-2-carboxamide?
The InChIKey is WAZKMMMYWHSEIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5O3/c1-17-6-7(13)4-8(17)11(18)16-12-14-9(19-2)5-10(15-12)20-3/h4-6H,13H2,1-3H3,(H,14,15,16,18).
What are the key properties of 4-amino-N-(4,6-dimethoxypyrimidin-2-yl)-1-methylpyrrole-2-carboxamide?
4-amino-N-(4,6-dimethoxypyrimidin-2-yl)-1-methylpyrrole-2-carboxamide has a molecular weight of 277.28 g/mol, XLogP of 0.67, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(4,6-dimethoxypyrimidin-2-yl)-1-methylpyrrole-2-carboxamide is sourced from PubChem (CID 107624352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).