C13H16ClIN2O2 — CID 107625438
4-(aminomethyl)-N-(4-chloro-2-iodophenyl)oxane-4-carboxamide (PubChem CID 107625438) has the molecular formula C13H16ClIN2O2 and a molecular weight of 394.64 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(4-chloro-2-iodophenyl)oxane-4-carboxamide.
| Compound Name | 4-(aminomethyl)-N-(4-chloro-2-iodophenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 107625438 |
| Molecular Formula | C13H16ClIN2O2 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 4-(aminomethyl)-N-(4-chloro-2-iodophenyl)oxane-4-carboxamide |
| SMILES | NCC1(C(=O)Nc2ccc(Cl)cc2I)CCOCC1 |
| InChI | InChI=1S/C13H16ClIN2O2/c14-9-1-2-11(10(15)7-9)17-12(18)13(8-16)3-5-19-6-4-13/h1-2,7H,3-6,8,16H2,(H,17,18) |
| InChIKey | UVESHLHUHMKLLC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|