C13H17N3O5 — CID 107744257
4-(aminomethyl)-N-(2-hydroxy-4-nitrophenyl)oxane-4-carboxamide (PubChem CID 107744257) has the molecular formula C13H17N3O5 and a molecular weight of 295.29 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2-hydroxy-4-nitrophenyl)oxane-4-carboxamide.
| Compound Name | 4-(aminomethyl)-N-(2-hydroxy-4-nitrophenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 107744257 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 4-(aminomethyl)-N-(2-hydroxy-4-nitrophenyl)oxane-4-carboxamide |
| SMILES | NCC1(C(=O)Nc2ccc([N+](=O)[O-])cc2O)CCOCC1 |
| InChI | InChI=1S/C13H17N3O5/c14-8-13(3-5-21-6-4-13)12(18)15-10-2-1-9(16(19)20)7-11(10)17/h1-2,7,17H,3-6,8,14H2,(H,15,18) |
| InChIKey | JPLBFIZOASNXMM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|