C13H20N4O3 — CID 107625898
N-(4,6-dimethoxypyrimidin-2-yl)-2-ethylpyrrolidine-2-carboxamide (PubChem CID 107625898) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is N-(4,6-dimethoxypyrimidin-2-yl)-2-ethylpyrrolidine-2-carboxamide.
| Compound Name | N-(4,6-dimethoxypyrimidin-2-yl)-2-ethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 107625898 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | N-(4,6-dimethoxypyrimidin-2-yl)-2-ethylpyrrolidine-2-carboxamide |
| SMILES | CCC1(C(=O)Nc2nc(OC)cc(OC)n2)CCCN1 |
| InChI | InChI=1S/C13H20N4O3/c1-4-13(6-5-7-14-13)11(18)17-12-15-9(19-2)8-10(16-12)20-3/h8,14H,4-7H2,1-3H3,(H,15,16,17,18) |
| InChIKey | IBGKIWULDCQBDR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |