C15H19N3O2 — CID 83072450
2-ethyl-N-(2-methyl-1,3-benzoxazol-5-yl)pyrrolidine-2-carboxamide (PubChem CID 83072450) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-ethyl-N-(2-methyl-1,3-benzoxazol-5-yl)pyrrolidine-2-carboxamide.
| Compound Name | 2-ethyl-N-(2-methyl-1,3-benzoxazol-5-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 83072450 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-ethyl-N-(2-methyl-1,3-benzoxazol-5-yl)pyrrolidine-2-carboxamide |
| SMILES | CCC1(C(=O)Nc2ccc3oc(C)nc3c2)CCCN1 |
| InChI | InChI=1S/C15H19N3O2/c1-3-15(7-4-8-16-15)14(19)18-11-5-6-13-12(9-11)17-10(2)20-13/h5-6,9,16H,3-4,7-8H2,1-2H3,(H,18,19) |
| InChIKey | CORHCRBFEPCXQY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |