C13H14ClIN2O4 — CID 107628223
2-[1-[(4-chloro-2-iodophenyl)carbamoyl]-3-methylazetidin-3-yl]oxyacetic acid (PubChem CID 107628223) has the molecular formula C13H14ClIN2O4 and a molecular weight of 424.62 g/mol. Its IUPAC name is 2-[1-[(4-chloro-2-iodophenyl)carbamoyl]-3-methylazetidin-3-yl]oxyacetic acid.
| Compound Name | 2-[1-[(4-chloro-2-iodophenyl)carbamoyl]-3-methylazetidin-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 107628223 |
| Molecular Formula | C13H14ClIN2O4 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | 2-[1-[(4-chloro-2-iodophenyl)carbamoyl]-3-methylazetidin-3-yl]oxyacetic acid |
| SMILES | CC1(OCC(=O)O)CN(C(=O)Nc2ccc(Cl)cc2I)C1 |
| InChI | InChI=1S/C13H14ClIN2O4/c1-13(21-5-11(18)19)6-17(7-13)12(20)16-10-3-2-8(14)4-9(10)15/h2-4H,5-7H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | MZVFFPIYNPZAEU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|