C10H10ClIN2O4 — CID 107628559
(2S)-2-[(4-chloro-2-iodophenyl)carbamoylamino]-3-hydroxypropanoic acid (PubChem CID 107628559) has the molecular formula C10H10ClIN2O4 and a molecular weight of 384.56 g/mol. Its IUPAC name is (2S)-2-[(4-chloro-2-iodophenyl)carbamoylamino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[(4-chloro-2-iodophenyl)carbamoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 107628559 |
| Molecular Formula | C10H10ClIN2O4 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | (2S)-2-[(4-chloro-2-iodophenyl)carbamoylamino]-3-hydroxypropanoic acid |
| SMILES | O=C(Nc1ccc(Cl)cc1I)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C10H10ClIN2O4/c11-5-1-2-7(6(12)3-5)13-10(18)14-8(4-15)9(16)17/h1-3,8,15H,4H2,(H,16,17)(H2,13,14,18)/t8-/m0/s1 |
| InChIKey | XBPGEBHEZIXBDB-QMMMGPOBSA-N |
| XLogP | 1.51 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|