C14H14ClIN2O — CID 107628895
8-chloro-N-ethyl-6-iodo-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-amine (PubChem CID 107628895) has the molecular formula C14H14ClIN2O and a molecular weight of 388.64 g/mol. Its IUPAC name is 8-chloro-N-ethyl-6-iodo-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-amine.
| Compound Name | 8-chloro-N-ethyl-6-iodo-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-amine |
|---|---|
| PubChem CID | 107628895 |
| Molecular Formula | C14H14ClIN2O |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 8-chloro-N-ethyl-6-iodo-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-amine |
| SMILES | CCNc1c2c(nc3c(I)cc(Cl)cc13)CCOC2 |
| InChI | InChI=1S/C14H14ClIN2O/c1-2-17-13-9-5-8(15)6-11(16)14(9)18-12-3-4-19-7-10(12)13/h5-6H,2-4,7H2,1H3,(H,17,18) |
| InChIKey | HCRIEFJLXYGHMW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|