C16H20N2O2 — CID 106473029
6-ethoxy-N-ethyl-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-amine (PubChem CID 106473029) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 6-ethoxy-N-ethyl-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-amine.
| Compound Name | 6-ethoxy-N-ethyl-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-amine |
|---|---|
| PubChem CID | 106473029 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 6-ethoxy-N-ethyl-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-amine |
| SMILES | CCNc1c2c(nc3c(OCC)cccc13)CCOC2 |
| InChI | InChI=1S/C16H20N2O2/c1-3-17-15-11-6-5-7-14(20-4-2)16(11)18-13-8-9-19-10-12(13)15/h5-7H,3-4,8-10H2,1-2H3,(H,17,18) |
| InChIKey | REFLGXXUPNCMRW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |