C15H19N3O2 — CID 106473795
[6-(2-methoxyethyl)-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-yl]hydrazine (PubChem CID 106473795) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is [6-(2-methoxyethyl)-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-yl]hydrazine.
| Compound Name | [6-(2-methoxyethyl)-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-yl]hydrazine |
|---|---|
| PubChem CID | 106473795 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | [6-(2-methoxyethyl)-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-yl]hydrazine |
| SMILES | COCCc1cccc2c(NN)c3c(nc12)CCOC3 |
| InChI | InChI=1S/C15H19N3O2/c1-19-7-5-10-3-2-4-11-14(10)17-13-6-8-20-9-12(13)15(11)18-16/h2-4H,5-9,16H2,1H3,(H,17,18) |
| InChIKey | QHUKAFJFVCVBFI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|