C14H15ClINO3 — CID 107629484
4-[(4-chloro-2-iodophenyl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 107629484) has the molecular formula C14H15ClINO3 and a molecular weight of 407.64 g/mol. Its IUPAC name is 4-[(4-chloro-2-iodophenyl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(4-chloro-2-iodophenyl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 107629484 |
| Molecular Formula | C14H15ClINO3 |
| Molecular Weight | 407.64 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | 4-[(4-chloro-2-iodophenyl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)Nc2ccc(Cl)cc2I)CC1 |
| InChI | InChI=1S/C14H15ClINO3/c15-10-5-6-12(11(16)7-10)17-13(18)8-1-3-9(4-2-8)14(19)20/h5-9H,1-4H2,(H,17,18)(H,19,20) |
| InChIKey | WVMBQXMBDNOLBJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.64 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|