C13H14ClIN2S — CID 107631525
4-chloro-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-iodoaniline (PubChem CID 107631525) has the molecular formula C13H14ClIN2S and a molecular weight of 392.69 g/mol. Its IUPAC name is 4-chloro-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-iodoaniline.
| Compound Name | 4-chloro-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-iodoaniline |
|---|---|
| PubChem CID | 107631525 |
| Molecular Formula | C13H14ClIN2S |
| Molecular Weight | 392.69 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | 4-chloro-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-iodoaniline |
| SMILES | Cc1nc(C)c(C(C)Nc2ccc(Cl)cc2I)s1 |
| InChI | InChI=1S/C13H14ClIN2S/c1-7-13(18-9(3)16-7)8(2)17-12-5-4-10(14)6-11(12)15/h4-6,8,17H,1-3H3 |
| InChIKey | OERFOQALODQQLG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.69 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|