C11H10BrFN2O3S — CID 107633329
5-[(2-bromo-5-fluoroanilino)methyl]furan-2-sulfonamide (PubChem CID 107633329) has the molecular formula C11H10BrFN2O3S and a molecular weight of 349.18 g/mol. Its IUPAC name is 5-[(2-bromo-5-fluoroanilino)methyl]furan-2-sulfonamide.
| Compound Name | 5-[(2-bromo-5-fluoroanilino)methyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 107633329 |
| Molecular Formula | C11H10BrFN2O3S |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 5-[(2-bromo-5-fluoroanilino)methyl]furan-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CNc2cc(F)ccc2Br)o1 |
| InChI | InChI=1S/C11H10BrFN2O3S/c12-9-3-1-7(13)5-10(9)15-6-8-2-4-11(18-8)19(14,16)17/h1-5,15H,6H2,(H2,14,16,17) |
| InChIKey | STVOTDRIWZYKPR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |