C8H8BrFN2O2S2 — CID 107626087
2-[(2-bromo-5-fluorophenyl)sulfamoyl]ethanethioamide (PubChem CID 107626087) has the molecular formula C8H8BrFN2O2S2 and a molecular weight of 327.20 g/mol. Its IUPAC name is 2-[(2-bromo-5-fluorophenyl)sulfamoyl]ethanethioamide.
| Compound Name | 2-[(2-bromo-5-fluorophenyl)sulfamoyl]ethanethioamide |
|---|---|
| PubChem CID | 107626087 |
| Molecular Formula | C8H8BrFN2O2S2 |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 325.92 |
| IUPAC Name | 2-[(2-bromo-5-fluorophenyl)sulfamoyl]ethanethioamide |
| SMILES | NC(=S)CS(=O)(=O)Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C8H8BrFN2O2S2/c9-6-2-1-5(10)3-7(6)12-16(13,14)4-8(11)15/h1-3,12H,4H2,(H2,11,15) |
| InChIKey | UOXZEIBVOITFPR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|