C18H15BrN2O2S — CID 10763673
5-bromo-2-(6-methyl-3-pyridinyl)-3-(4-methylsulfonylphenyl)pyridine (PubChem CID 10763673) has the molecular formula C18H15BrN2O2S and a molecular weight of 403.30 g/mol. Its IUPAC name is 5-bromo-2-(6-methyl-3-pyridinyl)-3-(4-methylsulfonylphenyl)pyridine.
| Compound Name | 5-bromo-2-(6-methyl-3-pyridinyl)-3-(4-methylsulfonylphenyl)pyridine |
|---|---|
| PubChem CID | 10763673 |
| Molecular Formula | C18H15BrN2O2S |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | 5-bromo-2-(6-methyl-3-pyridinyl)-3-(4-methylsulfonylphenyl)pyridine |
| SMILES | Cc1ccc(-c2ncc(Br)cc2-c2ccc(S(C)(=O)=O)cc2)cn1 |
| InChI | InChI=1S/C18H15BrN2O2S/c1-12-3-4-14(10-20-12)18-17(9-15(19)11-21-18)13-5-7-16(8-6-13)24(2,22)23/h3-11H,1-2H3 |
| InChIKey | OHUAFMWMWSBLFD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |