About CID 174159046
CID 174159046 (PubChem CID 174159046) has the molecular formula C18H11B4ClN2O2S
and a molecular weight of 398.07 g/mol.
Molecular Properties
| Compound Name | CID 174159046 |
| PubChem CID | 174159046 |
| Molecular Formula | C18H11B4ClN2O2S |
| Molecular Weight | 398.07 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c(S(C)(=O)=O)c([B])c([B])c1-c1cc(Cl)cnc1-c1ccc(C)nc1 |
| InChI | InChI=1S/C18H11B4ClN2O2S/c1-8-3-4-9(6-24-8)17-11(5-10(23)7-25-17)12-13(19)15(21)18(28(2,26)27)16(22)14(12)20/h3-7H,1-2H3 |
| InChIKey | RPCYUAIIMVFIMX-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.07 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174159046 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174159046?
The IUPAC name of CID 174159046 (CID 174159046) is not available.
What is the SMILES notation for CID 174159046?
The canonical SMILES for CID 174159046 is [B]c1c([B])c(S(C)(=O)=O)c([B])c([B])c1-c1cc(Cl)cnc1-c1ccc(C)nc1.
What is the InChIKey of CID 174159046?
The InChIKey is RPCYUAIIMVFIMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11B4ClN2O2S/c1-8-3-4-9(6-24-8)17-11(5-10(23)7-25-17)12-13(19)15(21)18(28(2,26)27)16(22)14(12)20/h3-7H,1-2H3.
What are the key properties of CID 174159046?
CID 174159046 has a molecular weight of 398.07 g/mol, XLogP of -0.65, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174159046 is sourced from PubChem (CID 174159046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).