C18H11B4ClN2O2S — CID 174159046
CID 174159046 (PubChem CID 174159046) has the molecular formula C18H11B4ClN2O2S and a molecular weight of 398.07 g/mol.
| Compound Name | CID 174159046 |
|---|---|
| PubChem CID | 174159046 |
| Molecular Formula | C18H11B4ClN2O2S |
| Molecular Weight | 398.07 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c(S(C)(=O)=O)c([B])c([B])c1-c1cc(Cl)cnc1-c1ccc(C)nc1 |
| InChI | InChI=1S/C18H11B4ClN2O2S/c1-8-3-4-9(6-24-8)17-11(5-10(23)7-25-17)12-13(19)15(21)18(28(2,26)27)16(22)14(12)20/h3-7H,1-2H3 |
| InChIKey | RPCYUAIIMVFIMX-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.07 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|