C11H9Br2N3 — CID 107636993
6-bromo-N-(3-bromo-2-methylphenyl)pyrimidin-4-amine (PubChem CID 107636993) has the molecular formula C11H9Br2N3 and a molecular weight of 343.02 g/mol. Its IUPAC name is 6-bromo-N-(3-bromo-2-methylphenyl)pyrimidin-4-amine.
| Compound Name | 6-bromo-N-(3-bromo-2-methylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107636993 |
| Molecular Formula | C11H9Br2N3 |
| Molecular Weight | 343.02 g/mol |
| Exact Mass | 340.92 |
| IUPAC Name | 6-bromo-N-(3-bromo-2-methylphenyl)pyrimidin-4-amine |
| SMILES | Cc1c(Br)cccc1Nc1cc(Br)ncn1 |
| InChI | InChI=1S/C11H9Br2N3/c1-7-8(12)3-2-4-9(7)16-11-5-10(13)14-6-15-11/h2-6H,1H3,(H,14,15,16) |
| InChIKey | XUIWJYXDMWTSOY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.02 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |