C17H15BrN4 — CID 112864909
4-N-(2-bromophenyl)-6-N-(3-methylphenyl)pyrimidine-4,6-diamine (PubChem CID 112864909) has the molecular formula C17H15BrN4 and a molecular weight of 355.24 g/mol. Its IUPAC name is 4-N-(2-bromophenyl)-6-N-(3-methylphenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-bromophenyl)-6-N-(3-methylphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112864909 |
| Molecular Formula | C17H15BrN4 |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 4-N-(2-bromophenyl)-6-N-(3-methylphenyl)pyrimidine-4,6-diamine |
| SMILES | Cc1cccc(Nc2cc(Nc3ccccc3Br)ncn2)c1 |
| InChI | InChI=1S/C17H15BrN4/c1-12-5-4-6-13(9-12)21-16-10-17(20-11-19-16)22-15-8-3-2-7-14(15)18/h2-11H,1H3,(H2,19,20,21,22) |
| InChIKey | XEVZUXBWIYCJQI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |