C17H25BrN2 — CID 107639879
2-(3-bromo-2-methylphenyl)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 107639879) has the molecular formula C17H25BrN2 and a molecular weight of 337.31 g/mol. Its IUPAC name is 2-(3-bromo-2-methylphenyl)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-(3-bromo-2-methylphenyl)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 107639879 |
| Molecular Formula | C17H25BrN2 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-(3-bromo-2-methylphenyl)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | Cc1c(Br)cccc1N1CC2CCCN2CC1C(C)C |
| InChI | InChI=1S/C17H25BrN2/c1-12(2)17-11-19-9-5-6-14(19)10-20(17)16-8-4-7-15(18)13(16)3/h4,7-8,12,14,17H,5-6,9-11H2,1-3H3 |
| InChIKey | ZMBZABREXSRJPK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |