C17H25ClN2O — CID 79922709
2-(5-chloro-2-methoxyphenyl)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 79922709) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 79922709 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | COc1ccc(Cl)cc1N1CC2CCCN2CC1C(C)C |
| InChI | InChI=1S/C17H25ClN2O/c1-12(2)16-11-19-8-4-5-14(19)10-20(16)15-9-13(18)6-7-17(15)21-3/h6-7,9,12,14,16H,4-5,8,10-11H2,1-3H3 |
| InChIKey | CKWSPQZZMYBLTR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |