C13H9ClF3IN2O — CID 107640576
N-(4-chloro-2-iodophenyl)-1-(2,2,2-trifluoroethyl)pyrrole-2-carboxamide (PubChem CID 107640576) has the molecular formula C13H9ClF3IN2O and a molecular weight of 428.58 g/mol. Its IUPAC name is N-(4-chloro-2-iodophenyl)-1-(2,2,2-trifluoroethyl)pyrrole-2-carboxamide.
| Compound Name | N-(4-chloro-2-iodophenyl)-1-(2,2,2-trifluoroethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 107640576 |
| Molecular Formula | C13H9ClF3IN2O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 427.94 |
| IUPAC Name | N-(4-chloro-2-iodophenyl)-1-(2,2,2-trifluoroethyl)pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1I)c1cccn1CC(F)(F)F |
| InChI | InChI=1S/C13H9ClF3IN2O/c14-8-3-4-10(9(18)6-8)19-12(21)11-2-1-5-20(11)7-13(15,16)17/h1-6H,7H2,(H,19,21) |
| InChIKey | CZLHGPCVKLPQLH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|