C13H12Cl2N2O2 — CID 107675583
N-(3,5-dichloro-2-hydroxyphenyl)-1-ethylpyrrole-2-carboxamide (PubChem CID 107675583) has the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.16 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxyphenyl)-1-ethylpyrrole-2-carboxamide.
| Compound Name | N-(3,5-dichloro-2-hydroxyphenyl)-1-ethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 107675583 |
| Molecular Formula | C13H12Cl2N2O2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxyphenyl)-1-ethylpyrrole-2-carboxamide |
| SMILES | CCn1cccc1C(=O)Nc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C13H12Cl2N2O2/c1-2-17-5-3-4-11(17)13(19)16-10-7-8(14)6-9(15)12(10)18/h3-7,18H,2H2,1H3,(H,16,19) |
| InChIKey | AYVPZBPSJYJHMR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|