C14H13ClN2O3 — CID 61398408
2-chloro-4-[(1-ethylpyrrole-2-carbonyl)amino]benzoic acid (PubChem CID 61398408) has the molecular formula C14H13ClN2O3 and a molecular weight of 292.72 g/mol. Its IUPAC name is 2-chloro-4-[(1-ethylpyrrole-2-carbonyl)amino]benzoic acid.
| Compound Name | 2-chloro-4-[(1-ethylpyrrole-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 61398408 |
| Molecular Formula | C14H13ClN2O3 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-chloro-4-[(1-ethylpyrrole-2-carbonyl)amino]benzoic acid |
| SMILES | CCn1cccc1C(=O)Nc1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C14H13ClN2O3/c1-2-17-7-3-4-12(17)13(18)16-9-5-6-10(14(19)20)11(15)8-9/h3-8H,2H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | CHAJTWAXRHTSGU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |