C14H11BrClFN2O — CID 107640736
1-(2-bromo-5-fluorophenyl)-3-(3-chloro-4-methylphenyl)urea (PubChem CID 107640736) has the molecular formula C14H11BrClFN2O and a molecular weight of 357.61 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-3-(3-chloro-4-methylphenyl)urea.
| Compound Name | 1-(2-bromo-5-fluorophenyl)-3-(3-chloro-4-methylphenyl)urea |
|---|---|
| PubChem CID | 107640736 |
| Molecular Formula | C14H11BrClFN2O |
| Molecular Weight | 357.61 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-3-(3-chloro-4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc(F)ccc2Br)cc1Cl |
| InChI | InChI=1S/C14H11BrClFN2O/c1-8-2-4-10(7-12(8)16)18-14(20)19-13-6-9(17)3-5-11(13)15/h2-7H,1H3,(H2,18,19,20) |
| InChIKey | OYTIEUMNTVDEAV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |