C13H18N4O3S — CID 107642586
2-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 107642586) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | 2-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 107642586 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | CCc1nnc(NC(=O)N2CC3CCCC3C2C(=O)O)s1 |
| InChI | InChI=1S/C13H18N4O3S/c1-2-9-15-16-12(21-9)14-13(20)17-6-7-4-3-5-8(7)10(17)11(18)19/h7-8,10H,2-6H2,1H3,(H,18,19)(H,14,16,20) |
| InChIKey | DTHJBLFWUFWBRV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |