C13H20N4OS — CID 99778298
(3aR,6aR)-N-(5-propyl-1,3,4-thiadiazol-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxamide (PubChem CID 99778298) has the molecular formula C13H20N4OS and a molecular weight of 280.40 g/mol. Its IUPAC name is (3aR,6aR)-N-(5-propyl-1,3,4-thiadiazol-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxamide.
| Compound Name | (3aR,6aR)-N-(5-propyl-1,3,4-thiadiazol-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 99778298 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (3aR,6aR)-N-(5-propyl-1,3,4-thiadiazol-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxamide |
| SMILES | CCCc1nnc(NC(=O)N2CC[C@H]3CCC[C@H]32)s1 |
| InChI | InChI=1S/C13H20N4OS/c1-2-4-11-15-16-12(19-11)14-13(18)17-8-7-9-5-3-6-10(9)17/h9-10H,2-8H2,1H3,(H,14,16,18)/t9-,10-/m1/s1 |
| InChIKey | FJXVJPHHFUNSOH-NXEZZACHSA-N |
| XLogP | 2.90 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |