C12H8ClF4NS — CID 107643647
N-[1-(5-chlorothiophen-2-yl)ethyl]-2,3,5,6-tetrafluoroaniline (PubChem CID 107643647) has the molecular formula C12H8ClF4NS and a molecular weight of 309.72 g/mol. Its IUPAC name is N-[1-(5-chlorothiophen-2-yl)ethyl]-2,3,5,6-tetrafluoroaniline.
| Compound Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 107643647 |
| Molecular Formula | C12H8ClF4NS |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-2,3,5,6-tetrafluoroaniline |
| SMILES | CC(Nc1c(F)c(F)cc(F)c1F)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H8ClF4NS/c1-5(8-2-3-9(13)19-8)18-12-10(16)6(14)4-7(15)11(12)17/h2-5,18H,1H3 |
| InChIKey | KWGQESDRGSKNMT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|