C13H12F4N2S — CID 107643800
N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2,3,5,6-tetrafluoroaniline (PubChem CID 107643800) has the molecular formula C13H12F4N2S and a molecular weight of 304.31 g/mol. Its IUPAC name is N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2,3,5,6-tetrafluoroaniline.
| Compound Name | N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 107643800 |
| Molecular Formula | C13H12F4N2S |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2,3,5,6-tetrafluoroaniline |
| SMILES | Cc1nc(C(C)Nc2c(F)c(F)cc(F)c2F)c(C)s1 |
| InChI | InChI=1S/C13H12F4N2S/c1-5(12-6(2)20-7(3)19-12)18-13-10(16)8(14)4-9(15)11(13)17/h4-5,18H,1-3H3 |
| InChIKey | IGAYDGVBRYLARL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|