C11H6F4N2O2S — CID 107643811
2,3,5,6-tetrafluoro-N-[(5-nitrothiophen-3-yl)methyl]aniline (PubChem CID 107643811) has the molecular formula C11H6F4N2O2S and a molecular weight of 306.24 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(5-nitrothiophen-3-yl)methyl]aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(5-nitrothiophen-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 107643811 |
| Molecular Formula | C11H6F4N2O2S |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(5-nitrothiophen-3-yl)methyl]aniline |
| SMILES | O=[N+]([O-])c1cc(CNc2c(F)c(F)cc(F)c2F)cs1 |
| InChI | InChI=1S/C11H6F4N2O2S/c12-6-2-7(13)10(15)11(9(6)14)16-3-5-1-8(17(18)19)20-4-5/h1-2,4,16H,3H2 |
| InChIKey | ULGUJNQFKKKHOP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|