C9H14N2O4S — CID 79811416
2-methyl-2-[(5-nitrothiophen-3-yl)methylamino]propane-1,3-diol (PubChem CID 79811416) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is 2-methyl-2-[(5-nitrothiophen-3-yl)methylamino]propane-1,3-diol.
| Compound Name | 2-methyl-2-[(5-nitrothiophen-3-yl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 79811416 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 2-methyl-2-[(5-nitrothiophen-3-yl)methylamino]propane-1,3-diol |
| SMILES | CC(CO)(CO)NCc1csc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H14N2O4S/c1-9(5-12,6-13)10-3-7-2-8(11(14)15)16-4-7/h2,4,10,12-13H,3,5-6H2,1H3 |
| InChIKey | JZXPJWRKUGQTIH-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|