C13H7F5N2S — CID 107644915
2-fluoro-6-(2,3,5,6-tetrafluoroanilino)benzenecarbothioamide (PubChem CID 107644915) has the molecular formula C13H7F5N2S and a molecular weight of 318.27 g/mol. Its IUPAC name is 2-fluoro-6-(2,3,5,6-tetrafluoroanilino)benzenecarbothioamide.
| Compound Name | 2-fluoro-6-(2,3,5,6-tetrafluoroanilino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107644915 |
| Molecular Formula | C13H7F5N2S |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 2-fluoro-6-(2,3,5,6-tetrafluoroanilino)benzenecarbothioamide |
| SMILES | NC(=S)c1c(F)cccc1Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H7F5N2S/c14-5-2-1-3-8(9(5)13(19)21)20-12-10(17)6(15)4-7(16)11(12)18/h1-4,20H,(H2,19,21) |
| InChIKey | UGTKHEHNTFYCOK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|