C11H11FN4S — CID 79779455
2-fluoro-6-[(1-methylpyrazol-3-yl)amino]benzenecarbothioamide (PubChem CID 79779455) has the molecular formula C11H11FN4S and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-fluoro-6-[(1-methylpyrazol-3-yl)amino]benzenecarbothioamide.
| Compound Name | 2-fluoro-6-[(1-methylpyrazol-3-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 79779455 |
| Molecular Formula | C11H11FN4S |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2-fluoro-6-[(1-methylpyrazol-3-yl)amino]benzenecarbothioamide |
| SMILES | Cn1ccc(Nc2cccc(F)c2C(N)=S)n1 |
| InChI | InChI=1S/C11H11FN4S/c1-16-6-5-9(15-16)14-8-4-2-3-7(12)10(8)11(13)17/h2-6H,1H3,(H2,13,17)(H,14,15) |
| InChIKey | XJBNTPNUWAABGO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|