C12H13ClN4S — CID 114253632
2-chloro-6-[(1,5-dimethylpyrazol-3-yl)amino]benzenecarbothioamide (PubChem CID 114253632) has the molecular formula C12H13ClN4S and a molecular weight of 280.78 g/mol. Its IUPAC name is 2-chloro-6-[(1,5-dimethylpyrazol-3-yl)amino]benzenecarbothioamide.
| Compound Name | 2-chloro-6-[(1,5-dimethylpyrazol-3-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114253632 |
| Molecular Formula | C12H13ClN4S |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-chloro-6-[(1,5-dimethylpyrazol-3-yl)amino]benzenecarbothioamide |
| SMILES | Cc1cc(Nc2cccc(Cl)c2C(N)=S)nn1C |
| InChI | InChI=1S/C12H13ClN4S/c1-7-6-10(16-17(7)2)15-9-5-3-4-8(13)11(9)12(14)18/h3-6H,1-2H3,(H2,14,18)(H,15,16) |
| InChIKey | ORWDLLBHFWEZRF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|