C15H22N2S — CID 107646320
3-cyclopropyl-1-(2-methylsulfanylphenyl)-1,4-diazepane (PubChem CID 107646320) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2-methylsulfanylphenyl)-1,4-diazepane.
| Compound Name | 3-cyclopropyl-1-(2-methylsulfanylphenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 107646320 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 3-cyclopropyl-1-(2-methylsulfanylphenyl)-1,4-diazepane |
| SMILES | CSc1ccccc1N1CCCNC(C2CC2)C1 |
| InChI | InChI=1S/C15H22N2S/c1-18-15-6-3-2-5-14(15)17-10-4-9-16-13(11-17)12-7-8-12/h2-3,5-6,12-13,16H,4,7-11H2,1H3 |
| InChIKey | QSEXDLFPKBGCRG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |