About 3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane
3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane (PubChem CID 64944097) has the molecular formula C19H30N2
and a molecular weight of 286.46 g/mol. Its IUPAC name is 3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane.
Molecular Properties
| Compound Name | 3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane |
| PubChem CID | 64944097 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane |
| SMILES | Cc1cccc(N2CCCNC(C3CCCCC3)C2)c1C |
| InChI | InChI=1S/C19H30N2/c1-15-8-6-11-19(16(15)2)21-13-7-12-20-18(14-21)17-9-4-3-5-10-17/h6,8,11,17-18,20H,3-5,7,9-10,12-14H2,1-2H3 |
| InChIKey | ZZZMKJVMJPDGKR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane?
The IUPAC name of 3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane (CID 64944097) is 3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane.
What is the SMILES notation for 3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane?
The canonical SMILES for 3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane is Cc1cccc(N2CCCNC(C3CCCCC3)C2)c1C.
What is the InChIKey of 3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane?
The InChIKey is ZZZMKJVMJPDGKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2/c1-15-8-6-11-19(16(15)2)21-13-7-12-20-18(14-21)17-9-4-3-5-10-17/h6,8,11,17-18,20H,3-5,7,9-10,12-14H2,1-2H3.
What are the key properties of 3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane?
3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane has a molecular weight of 286.46 g/mol, XLogP of 4.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane is sourced from PubChem (CID 64944097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).