C19H30N2 — CID 64944097
3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane (PubChem CID 64944097) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane.
| Compound Name | 3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64944097 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 3-cyclohexyl-1-(2,3-dimethylphenyl)-1,4-diazepane |
| SMILES | Cc1cccc(N2CCCNC(C3CCCCC3)C2)c1C |
| InChI | InChI=1S/C19H30N2/c1-15-8-6-11-19(16(15)2)21-13-7-12-20-18(14-21)17-9-4-3-5-10-17/h6,8,11,17-18,20H,3-5,7,9-10,12-14H2,1-2H3 |
| InChIKey | ZZZMKJVMJPDGKR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |