C11H8F4N4O — CID 107647101
5-methoxy-4-N-(2,3,5,6-tetrafluorophenyl)pyrimidine-4,6-diamine (PubChem CID 107647101) has the molecular formula C11H8F4N4O and a molecular weight of 288.20 g/mol. Its IUPAC name is 5-methoxy-4-N-(2,3,5,6-tetrafluorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 5-methoxy-4-N-(2,3,5,6-tetrafluorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 107647101 |
| Molecular Formula | C11H8F4N4O |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 5-methoxy-4-N-(2,3,5,6-tetrafluorophenyl)pyrimidine-4,6-diamine |
| SMILES | COc1c(N)ncnc1Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C11H8F4N4O/c1-20-9-10(16)17-3-18-11(9)19-8-6(14)4(12)2-5(13)7(8)15/h2-3H,1H3,(H3,16,17,18,19) |
| InChIKey | SJEUKSPBRXNFRP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|