C13H16FN3S — CID 107648562
N-[1-(4-fluorophenyl)pentyl]-1,3,4-thiadiazol-2-amine (PubChem CID 107648562) has the molecular formula C13H16FN3S and a molecular weight of 265.36 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)pentyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[1-(4-fluorophenyl)pentyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107648562 |
| Molecular Formula | C13H16FN3S |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-[1-(4-fluorophenyl)pentyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CCCCC(Nc1nncs1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H16FN3S/c1-2-3-4-12(16-13-17-15-9-18-13)10-5-7-11(14)8-6-10/h5-9,12H,2-4H2,1H3,(H,16,17) |
| InChIKey | ISIAHJSQHHMUAV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |