C17H18Cl2FN — CID 43099420
3,4-dichloro-N-[1-(4-fluorophenyl)pentyl]aniline (PubChem CID 43099420) has the molecular formula C17H18Cl2FN and a molecular weight of 326.24 g/mol. Its IUPAC name is 3,4-dichloro-N-[1-(4-fluorophenyl)pentyl]aniline.
| Compound Name | 3,4-dichloro-N-[1-(4-fluorophenyl)pentyl]aniline |
|---|---|
| PubChem CID | 43099420 |
| Molecular Formula | C17H18Cl2FN |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 3,4-dichloro-N-[1-(4-fluorophenyl)pentyl]aniline |
| SMILES | CCCCC(Nc1ccc(Cl)c(Cl)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18Cl2FN/c1-2-3-4-17(12-5-7-13(20)8-6-12)21-14-9-10-15(18)16(19)11-14/h5-11,17,21H,2-4H2,1H3 |
| InChIKey | DRWCZCFEDUNKFP-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |