C26H24O6 — CID 10765170
10-[4-(3,4-dimethoxyphenyl)butanoyl]-1,8-dihydroxy-10H-anthracen-9-one (PubChem CID 10765170) has the molecular formula C26H24O6 and a molecular weight of 432.47 g/mol. Its IUPAC name is 10-[4-(3,4-dimethoxyphenyl)butanoyl]-1,8-dihydroxy-10H-anthracen-9-one.
| Compound Name | 10-[4-(3,4-dimethoxyphenyl)butanoyl]-1,8-dihydroxy-10H-anthracen-9-one |
|---|---|
| PubChem CID | 10765170 |
| Molecular Formula | C26H24O6 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 10-[4-(3,4-dimethoxyphenyl)butanoyl]-1,8-dihydroxy-10H-anthracen-9-one |
| SMILES | COc1ccc(CCCC(=O)C2c3cccc(O)c3C(=O)c3c(O)cccc32)cc1OC |
| InChI | InChI=1S/C26H24O6/c1-31-21-13-12-15(14-22(21)32-2)6-3-9-18(27)23-16-7-4-10-19(28)24(16)26(30)25-17(23)8-5-11-20(25)29/h4-5,7-8,10-14,23,28-29H,3,6,9H2,1-2H3 |
| InChIKey | RMRCFMAFMUYRHE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |