C13H16FNO3S2 — CID 107651964
3-fluoro-4-(3-hydroxyprop-1-ynyl)-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide (PubChem CID 107651964) has the molecular formula C13H16FNO3S2 and a molecular weight of 317.41 g/mol. Its IUPAC name is 3-fluoro-4-(3-hydroxyprop-1-ynyl)-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide.
| Compound Name | 3-fluoro-4-(3-hydroxyprop-1-ynyl)-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 107651964 |
| Molecular Formula | C13H16FNO3S2 |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 3-fluoro-4-(3-hydroxyprop-1-ynyl)-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide |
| SMILES | CSCC(C)NS(=O)(=O)c1ccc(C#CCO)c(F)c1 |
| InChI | InChI=1S/C13H16FNO3S2/c1-10(9-19-2)15-20(17,18)12-6-5-11(4-3-7-16)13(14)8-12/h5-6,8,10,15-16H,7,9H2,1-2H3 |
| InChIKey | KZKYUOLHSRATIH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|