C14H19FN2O2S2 — CID 107652840
4-(3-aminoprop-1-ynyl)-N-(1-ethylsulfanylpropan-2-yl)-3-fluorobenzenesulfonamide (PubChem CID 107652840) has the molecular formula C14H19FN2O2S2 and a molecular weight of 330.45 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-N-(1-ethylsulfanylpropan-2-yl)-3-fluorobenzenesulfonamide.
| Compound Name | 4-(3-aminoprop-1-ynyl)-N-(1-ethylsulfanylpropan-2-yl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 107652840 |
| Molecular Formula | C14H19FN2O2S2 |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-N-(1-ethylsulfanylpropan-2-yl)-3-fluorobenzenesulfonamide |
| SMILES | CCSCC(C)NS(=O)(=O)c1ccc(C#CCN)c(F)c1 |
| InChI | InChI=1S/C14H19FN2O2S2/c1-3-20-10-11(2)17-21(18,19)13-7-6-12(5-4-8-16)14(15)9-13/h6-7,9,11,17H,3,8,10,16H2,1-2H3 |
| InChIKey | XWZZIKFECKERQA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|