C10H20ClNO2S — CID 107652071
2-chloro-N-(3,4-dimethylcyclohexyl)ethanesulfonamide (PubChem CID 107652071) has the molecular formula C10H20ClNO2S and a molecular weight of 253.79 g/mol. Its IUPAC name is 2-chloro-N-(3,4-dimethylcyclohexyl)ethanesulfonamide.
| Compound Name | 2-chloro-N-(3,4-dimethylcyclohexyl)ethanesulfonamide |
|---|---|
| PubChem CID | 107652071 |
| Molecular Formula | C10H20ClNO2S |
| Molecular Weight | 253.79 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-chloro-N-(3,4-dimethylcyclohexyl)ethanesulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)CCCl)CC1C |
| InChI | InChI=1S/C10H20ClNO2S/c1-8-3-4-10(7-9(8)2)12-15(13,14)6-5-11/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | LYYUCLVOFWFLEE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.79 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|