C9H18ClNO2S — CID 107652077
2-chloro-N-(2,3-dimethylcyclopentyl)ethanesulfonamide (PubChem CID 107652077) has the molecular formula C9H18ClNO2S and a molecular weight of 239.77 g/mol. Its IUPAC name is 2-chloro-N-(2,3-dimethylcyclopentyl)ethanesulfonamide.
| Compound Name | 2-chloro-N-(2,3-dimethylcyclopentyl)ethanesulfonamide |
|---|---|
| PubChem CID | 107652077 |
| Molecular Formula | C9H18ClNO2S |
| Molecular Weight | 239.77 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2-chloro-N-(2,3-dimethylcyclopentyl)ethanesulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)CCCl)C1C |
| InChI | InChI=1S/C9H18ClNO2S/c1-7-3-4-9(8(7)2)11-14(12,13)6-5-10/h7-9,11H,3-6H2,1-2H3 |
| InChIKey | VYCQHRWECYFLRE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.77 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|