C8H16ClNO3S — CID 107858968
2-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]ethanesulfonamide (PubChem CID 107858968) has the molecular formula C8H16ClNO3S and a molecular weight of 241.74 g/mol. Its IUPAC name is 2-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]ethanesulfonamide.
| Compound Name | 2-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]ethanesulfonamide |
|---|---|
| PubChem CID | 107858968 |
| Molecular Formula | C8H16ClNO3S |
| Molecular Weight | 241.74 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]ethanesulfonamide |
| SMILES | O=S(=O)(CCCl)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C8H16ClNO3S/c9-5-6-14(12,13)10-7-3-1-2-4-8(7)11/h7-8,10-11H,1-6H2/t7-,8-/m0/s1 |
| InChIKey | VBBZKAZGZDZNQJ-YUMQZZPRSA-N |
| XLogP | 0.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.74 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|