C9H18ClNO3S — CID 107858978
3-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]propane-1-sulfonamide (PubChem CID 107858978) has the molecular formula C9H18ClNO3S and a molecular weight of 255.77 g/mol. Its IUPAC name is 3-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 107858978 |
| Molecular Formula | C9H18ClNO3S |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C9H18ClNO3S/c10-6-3-7-15(13,14)11-8-4-1-2-5-9(8)12/h8-9,11-12H,1-7H2/t8-,9-/m1/s1 |
| InChIKey | UWCFGKPIRFAMNG-RKDXNWHRSA-N |
| XLogP | 0.84 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|