C10H19NO5S — CID 107216293
4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]butanoic acid (PubChem CID 107216293) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is 4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]butanoic acid.
| Compound Name | 4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 107216293 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]butanoic acid |
| SMILES | O=C(O)CCCS(=O)(=O)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C10H19NO5S/c12-9-5-2-1-4-8(9)11-17(15,16)7-3-6-10(13)14/h8-9,11-12H,1-7H2,(H,13,14)/t8-,9-/m1/s1 |
| InChIKey | NZKXZZLBHTYGGU-RKDXNWHRSA-N |
| XLogP | 0.07 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |