C11H21NO4S2 — CID 114122691
4-[(4-methylsulfanylcyclohexyl)sulfamoyl]butanoic acid (PubChem CID 114122691) has the molecular formula C11H21NO4S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 4-[(4-methylsulfanylcyclohexyl)sulfamoyl]butanoic acid.
| Compound Name | 4-[(4-methylsulfanylcyclohexyl)sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 114122691 |
| Molecular Formula | C11H21NO4S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 4-[(4-methylsulfanylcyclohexyl)sulfamoyl]butanoic acid |
| SMILES | CSC1CCC(NS(=O)(=O)CCCC(=O)O)CC1 |
| InChI | InChI=1S/C11H21NO4S2/c1-17-10-6-4-9(5-7-10)12-18(15,16)8-2-3-11(13)14/h9-10,12H,2-8H2,1H3,(H,13,14) |
| InChIKey | GWPFYDKPXKKXEO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |