C20H17F3N4O2S — CID 10765265
2-[[4-(dimethylamino)-2,3,6-trifluorophenyl]methylsulfinyl]-N-pyridin-4-ylpyridine-3-carboxamide (PubChem CID 10765265) has the molecular formula C20H17F3N4O2S and a molecular weight of 434.44 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)-2,3,6-trifluorophenyl]methylsulfinyl]-N-pyridin-4-ylpyridine-3-carboxamide.
| Compound Name | 2-[[4-(dimethylamino)-2,3,6-trifluorophenyl]methylsulfinyl]-N-pyridin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 10765265 |
| Molecular Formula | C20H17F3N4O2S |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 2-[[4-(dimethylamino)-2,3,6-trifluorophenyl]methylsulfinyl]-N-pyridin-4-ylpyridine-3-carboxamide |
| SMILES | CN(C)c1cc(F)c(CS(=O)c2ncccc2C(=O)Nc2ccncc2)c(F)c1F |
| InChI | InChI=1S/C20H17F3N4O2S/c1-27(2)16-10-15(21)14(17(22)18(16)23)11-30(29)20-13(4-3-7-25-20)19(28)26-12-5-8-24-9-6-12/h3-10H,11H2,1-2H3,(H,24,26,28) |
| InChIKey | KXJTVRPYCKBYKP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|