C25H28N2O2S — CID 10342105
2-benzylsulfinyl-N-[2,6-di(propan-2-yl)phenyl]pyridine-3-carboxamide (PubChem CID 10342105) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is 2-benzylsulfinyl-N-[2,6-di(propan-2-yl)phenyl]pyridine-3-carboxamide.
| Compound Name | 2-benzylsulfinyl-N-[2,6-di(propan-2-yl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10342105 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 2-benzylsulfinyl-N-[2,6-di(propan-2-yl)phenyl]pyridine-3-carboxamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)c1cccnc1S(=O)Cc1ccccc1 |
| InChI | InChI=1S/C25H28N2O2S/c1-17(2)20-12-8-13-21(18(3)4)23(20)27-24(28)22-14-9-15-26-25(22)30(29)16-19-10-6-5-7-11-19/h5-15,17-18H,16H2,1-4H3,(H,27,28) |
| InChIKey | FIDSPKGDVQUNTJ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |