C22H30O5SSi — CID 10765297
methyl 7-(benzenesulfinyl)-4-[tert-butyl(dimethyl)silyl]oxy-6,7a-dihydro-5H-1-benzofuran-7-carboxylate (PubChem CID 10765297) has the molecular formula C22H30O5SSi and a molecular weight of 434.63 g/mol. Its IUPAC name is methyl 7-(benzenesulfinyl)-4-[tert-butyl(dimethyl)silyl]oxy-6,7a-dihydro-5H-1-benzofuran-7-carboxylate.
| Compound Name | methyl 7-(benzenesulfinyl)-4-[tert-butyl(dimethyl)silyl]oxy-6,7a-dihydro-5H-1-benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 10765297 |
| Molecular Formula | C22H30O5SSi |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | methyl 7-(benzenesulfinyl)-4-[tert-butyl(dimethyl)silyl]oxy-6,7a-dihydro-5H-1-benzofuran-7-carboxylate |
| SMILES | COC(=O)C1(S(=O)c2ccccc2)CCC(O[Si](C)(C)C(C)(C)C)=C2C=COC21 |
| InChI | InChI=1S/C22H30O5SSi/c1-21(2,3)29(5,6)27-18-12-14-22(20(23)25-4,19-17(18)13-15-26-19)28(24)16-10-8-7-9-11-16/h7-11,13,15,19H,12,14H2,1-6H3 |
| InChIKey | UDWWGDDEWYSBEO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|